C27H18N3O2PtS-3 — CID 153431737
2-[[2-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-3H-dibenzothiophen-3-id-4-yl]oxy]pyridine;platinum (PubChem CID 153431737) has the molecular formula C27H18N3O2PtS-3 and a molecular weight of 643.61 g/mol. Its IUPAC name is 2-[[2-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-3H-dibenzothiophen-3-id-4-yl]oxy]pyridine;platinum.
| Compound Name | 2-[[2-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-3H-dibenzothiophen-3-id-4-yl]oxy]pyridine;platinum |
|---|---|
| PubChem CID | 153431737 |
| Molecular Formula | C27H18N3O2PtS-3 |
| Molecular Weight | 643.61 g/mol |
| Exact Mass | 643.08 |
| IUPAC Name | 2-[[2-[3-(3-methyl-2H-imidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-3H-dibenzothiophen-3-id-4-yl]oxy]pyridine;platinum |
| SMILES | CN1C=CN(c2[c-]c(Oc3[c-]c(Oc4ccccn4)c4sc5ccccc5c4c3)ccc2)[CH-]1.[Pt] |
| InChI | InChI=1S/C27H18N3O2S.Pt/c1-29-13-14-30(18-29)19-7-6-8-20(15-19)31-21-16-23-22-9-2-3-10-25(22)33-27(23)24(17-21)32-26-11-4-5-12-28-26;/h2-14,16,18H,1H3;/q-3; |
| InChIKey | RRSHPPIJILFWCQ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|