C33H22N4O2Pt — CID 153431925
N-[3-[3-(1-methylpyrazol-3-yl)benzene-2-id-1-yl]oxy-2H-dibenzofuran-2-id-1-yl]-N-phenylpyridin-2-amine;platinum(2+) (PubChem CID 153431925) has the molecular formula C33H22N4O2Pt and a molecular weight of 701.64 g/mol. Its IUPAC name is N-[3-[3-(1-methylpyrazol-3-yl)benzene-2-id-1-yl]oxy-2H-dibenzofuran-2-id-1-yl]-N-phenylpyridin-2-amine;platinum(2+).
| Compound Name | N-[3-[3-(1-methylpyrazol-3-yl)benzene-2-id-1-yl]oxy-2H-dibenzofuran-2-id-1-yl]-N-phenylpyridin-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 153431925 |
| Molecular Formula | C33H22N4O2Pt |
| Molecular Weight | 701.64 g/mol |
| Exact Mass | 701.14 |
| IUPAC Name | N-[3-[3-(1-methylpyrazol-3-yl)benzene-2-id-1-yl]oxy-2H-dibenzofuran-2-id-1-yl]-N-phenylpyridin-2-amine;platinum(2+) |
| SMILES | Cn1ccc(-c2[c-]c(Oc3[c-]c(N(c4ccccc4)c4ccccn4)c4c(c3)oc3ccccc34)ccc2)n1.[Pt+2] |
| InChI | InChI=1S/C33H22N4O2.Pt/c1-36-19-17-28(35-36)23-10-9-13-25(20-23)38-26-21-29(33-27-14-5-6-15-30(27)39-31(33)22-26)37(24-11-3-2-4-12-24)32-16-7-8-18-34-32;/h2-19,22H,1H3;/q-2;+2 |
| InChIKey | BCBGEDBHQZLBOM-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.64 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|