About 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione
7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione (PubChem CID 153432371) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione.
Molecular Properties
| Compound Name | 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione |
| PubChem CID | 153432371 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione |
| SMILES | Cc1cc(=O)nc2ccn(C(C)(C)C)c(=O)n12 |
| InChI | InChI=1S/C12H15N3O2/c1-8-7-10(16)13-9-5-6-14(12(2,3)4)11(17)15(8)9/h5-7H,1-4H3 |
| InChIKey | RUYABIPNIOKLMP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione?
The IUPAC name of 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione (CID 153432371) is 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione.
What is the SMILES notation for 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione?
The canonical SMILES for 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione is Cc1cc(=O)nc2ccn(C(C)(C)C)c(=O)n12.
What is the InChIKey of 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione?
The InChIKey is RUYABIPNIOKLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c1-8-7-10(16)13-9-5-6-14(12(2,3)4)11(17)15(8)9/h5-7H,1-4H3.
What are the key properties of 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione?
7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione has a molecular weight of 233.27 g/mol, XLogP of 0.92, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-4-methylpyrimido[1,2-c]pyrimidine-2,6-dione is sourced from PubChem (CID 153432371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).