C26H29NO4 — CID 153432433
[14-[2-(dimethylamino)ethyl]-11-(hydroxymethyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,8(13),9,11-tetraen-2-yl] benzoate (PubChem CID 153432433) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is [14-[2-(dimethylamino)ethyl]-11-(hydroxymethyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,8(13),9,11-tetraen-2-yl] benzoate.
| Compound Name | [14-[2-(dimethylamino)ethyl]-11-(hydroxymethyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,8(13),9,11-tetraen-2-yl] benzoate |
|---|---|
| PubChem CID | 153432433 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | [14-[2-(dimethylamino)ethyl]-11-(hydroxymethyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,8(13),9,11-tetraen-2-yl] benzoate |
| SMILES | CN(C)CCC12c3c4ccc(CO)c3OC1C(OC(=O)c1ccccc1)=CCC2CC4 |
| InChI | InChI=1S/C26H29NO4/c1-27(2)15-14-26-20-11-10-17-8-9-19(16-28)23(22(17)26)31-24(26)21(13-12-20)30-25(29)18-6-4-3-5-7-18/h3-9,13,20,24,28H,10-12,14-16H2,1-2H3 |
| InChIKey | CJUXJLVWBMLLPL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |