C19H20F4N4O2 — CID 153432447
N-(1-tert-butyl-6-isocyano-4-methoxybenzimidazol-2-yl)-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide (PubChem CID 153432447) has the molecular formula C19H20F4N4O2 and a molecular weight of 412.39 g/mol. Its IUPAC name is N-(1-tert-butyl-6-isocyano-4-methoxybenzimidazol-2-yl)-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide.
| Compound Name | N-(1-tert-butyl-6-isocyano-4-methoxybenzimidazol-2-yl)-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide |
|---|---|
| PubChem CID | 153432447 |
| Molecular Formula | C19H20F4N4O2 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-(1-tert-butyl-6-isocyano-4-methoxybenzimidazol-2-yl)-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide |
| SMILES | [C-]#[N+]c1cc(OC)c2nc(NC(=O)CC3CC(F)(F)C3(F)F)n(C(C)(C)C)c2c1 |
| InChI | InChI=1S/C19H20F4N4O2/c1-17(2,3)27-12-7-11(24-4)8-13(29-5)15(12)26-16(27)25-14(28)6-10-9-18(20,21)19(10,22)23/h7-8,10H,6,9H2,1-3,5H3,(H,25,26,28) |
| InChIKey | NKGWNMVONJHENN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|