C20H20F4N4O2 — CID 153432478
N-[6-isocyano-4-methoxy-1-(1-methylcyclobutyl)benzimidazol-2-yl]-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide (PubChem CID 153432478) has the molecular formula C20H20F4N4O2 and a molecular weight of 424.40 g/mol. Its IUPAC name is N-[6-isocyano-4-methoxy-1-(1-methylcyclobutyl)benzimidazol-2-yl]-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide.
| Compound Name | N-[6-isocyano-4-methoxy-1-(1-methylcyclobutyl)benzimidazol-2-yl]-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide |
|---|---|
| PubChem CID | 153432478 |
| Molecular Formula | C20H20F4N4O2 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[6-isocyano-4-methoxy-1-(1-methylcyclobutyl)benzimidazol-2-yl]-2-(2,2,3,3-tetrafluorocyclobutyl)acetamide |
| SMILES | [C-]#[N+]c1cc(OC)c2nc(NC(=O)CC3CC(F)(F)C3(F)F)n(C3(C)CCC3)c2c1 |
| InChI | InChI=1S/C20H20F4N4O2/c1-18(5-4-6-18)28-13-8-12(25-2)9-14(30-3)16(13)27-17(28)26-15(29)7-11-10-19(21,22)20(11,23)24/h8-9,11H,4-7,10H2,1,3H3,(H,26,27,29) |
| InChIKey | SYRYTIBVIRSDMF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|