C19H21F3N4O2 — CID 153432486
N-(1-tert-butyl-6-isocyano-4-methoxybenzimidazol-2-yl)-2-[1-(trifluoromethyl)cyclopropyl]acetamide (PubChem CID 153432486) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is N-(1-tert-butyl-6-isocyano-4-methoxybenzimidazol-2-yl)-2-[1-(trifluoromethyl)cyclopropyl]acetamide.
| Compound Name | N-(1-tert-butyl-6-isocyano-4-methoxybenzimidazol-2-yl)-2-[1-(trifluoromethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 153432486 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(1-tert-butyl-6-isocyano-4-methoxybenzimidazol-2-yl)-2-[1-(trifluoromethyl)cyclopropyl]acetamide |
| SMILES | [C-]#[N+]c1cc(OC)c2nc(NC(=O)CC3(C(F)(F)F)CC3)n(C(C)(C)C)c2c1 |
| InChI | InChI=1S/C19H21F3N4O2/c1-17(2,3)26-12-8-11(23-4)9-13(28-5)15(12)25-16(26)24-14(27)10-18(6-7-18)19(20,21)22/h8-9H,6-7,10H2,1-3,5H3,(H,24,25,27) |
| InChIKey | QRMILBPPYOVCEA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|