C15H22N2O3 — CID 153432609
(2E)-2-[2-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]ethylidene]-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 153432609) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (2E)-2-[2-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]ethylidene]-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | (2E)-2-[2-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]ethylidene]-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 153432609 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (2E)-2-[2-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]ethylidene]-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | CC(C)(C)C(=O)/C(C#N)=C/CN1C[C@@H]2OCCO[C@@H]2C1 |
| InChI | InChI=1S/C15H22N2O3/c1-15(2,3)14(18)11(8-16)4-5-17-9-12-13(10-17)20-7-6-19-12/h4,12-13H,5-7,9-10H2,1-3H3/b11-4+/t12-,13+ |
| InChIKey | RHRCYCUNDZTJLJ-FWXODLJWSA-N |
| XLogP | 1.15 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|