C45H36IrN4O-2 — CID 153432943
10-(4-tert-butylphenyl)-3-pyridin-2-yl-4H-phenoxazin-4-ide;iridium;9-methyl-1-pyridin-2-yl-2H-carbazol-2-ide (PubChem CID 153432943) has the molecular formula C45H36IrN4O-2 and a molecular weight of 841.03 g/mol. Its IUPAC name is 10-(4-tert-butylphenyl)-3-pyridin-2-yl-4H-phenoxazin-4-ide;iridium;9-methyl-1-pyridin-2-yl-2H-carbazol-2-ide.
| Compound Name | 10-(4-tert-butylphenyl)-3-pyridin-2-yl-4H-phenoxazin-4-ide;iridium;9-methyl-1-pyridin-2-yl-2H-carbazol-2-ide |
|---|---|
| PubChem CID | 153432943 |
| Molecular Formula | C45H36IrN4O-2 |
| Molecular Weight | 841.03 g/mol |
| Exact Mass | 841.25 |
| IUPAC Name | 10-(4-tert-butylphenyl)-3-pyridin-2-yl-4H-phenoxazin-4-ide;iridium;9-methyl-1-pyridin-2-yl-2H-carbazol-2-ide |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(-c4ccccn4)[c-]c3Oc3ccccc32)cc1.Cn1c2ccccc2c2cc[c-]c(-c3ccccn3)c21.[Ir] |
| InChI | InChI=1S/C27H23N2O.C18H13N2.Ir/c1-27(2,3)20-12-14-21(15-13-20)29-23-9-4-5-10-25(23)30-26-18-19(11-16-24(26)29)22-8-6-7-17-28-22;1-20-17-11-3-2-7-13(17)14-8-6-9-15(18(14)20)16-10-4-5-12-19-16;/h4-17H,1-3H3;2-8,10-12H,1H3;/q2*-1; |
| InChIKey | VHCDZPCNZFEQNE-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.03 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|