C43H37IrN3OS-2 — CID 153432996
10-(4-tert-butylphenyl)-4-thieno[3,2-c]pyridin-4-yl-3H-phenoxazin-3-ide;iridium;2-(3,4,5-trimethylbenzene-6-id-1-yl)pyridine (PubChem CID 153432996) has the molecular formula C43H37IrN3OS-2 and a molecular weight of 836.07 g/mol. Its IUPAC name is 10-(4-tert-butylphenyl)-4-thieno[3,2-c]pyridin-4-yl-3H-phenoxazin-3-ide;iridium;2-(3,4,5-trimethylbenzene-6-id-1-yl)pyridine.
| Compound Name | 10-(4-tert-butylphenyl)-4-thieno[3,2-c]pyridin-4-yl-3H-phenoxazin-3-ide;iridium;2-(3,4,5-trimethylbenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 153432996 |
| Molecular Formula | C43H37IrN3OS-2 |
| Molecular Weight | 836.07 g/mol |
| Exact Mass | 836.23 |
| IUPAC Name | 10-(4-tert-butylphenyl)-4-thieno[3,2-c]pyridin-4-yl-3H-phenoxazin-3-ide;iridium;2-(3,4,5-trimethylbenzene-6-id-1-yl)pyridine |
| SMILES | CC(C)(C)c1ccc(N2c3ccccc3Oc3c(-c4nccc5sccc45)[c-]ccc32)cc1.Cc1[c-]c(-c2ccccn2)cc(C)c1C.[Ir] |
| InChI | InChI=1S/C29H23N2OS.C14H14N.Ir/c1-29(2,3)19-11-13-20(14-12-19)31-23-8-4-5-10-25(23)32-28-22(7-6-9-24(28)31)27-21-16-18-33-26(21)15-17-30-27;1-10-8-13(9-11(2)12(10)3)14-6-4-5-7-15-14;/h4-6,8-18H,1-3H3;4-8H,1-3H3;/q2*-1; |
| InChIKey | BEQYGEFYXVWMDT-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.07 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|