C42H34IrN2OS2Si-2 — CID 153433079
2-(4-cyclohexylbenzene-6-id-1-yl)pyridine;2-(10,10-dithiophen-2-yl-3H-benzo[b][1,4]benzoxasilin-3-id-4-yl)pyridine;iridium (PubChem CID 153433079) has the molecular formula C42H34IrN2OS2Si-2 and a molecular weight of 867.18 g/mol. Its IUPAC name is 2-(4-cyclohexylbenzene-6-id-1-yl)pyridine;2-(10,10-dithiophen-2-yl-3H-benzo[b][1,4]benzoxasilin-3-id-4-yl)pyridine;iridium.
| Compound Name | 2-(4-cyclohexylbenzene-6-id-1-yl)pyridine;2-(10,10-dithiophen-2-yl-3H-benzo[b][1,4]benzoxasilin-3-id-4-yl)pyridine;iridium |
|---|---|
| PubChem CID | 153433079 |
| Molecular Formula | C42H34IrN2OS2Si-2 |
| Molecular Weight | 867.18 g/mol |
| Exact Mass | 867.15 |
| IUPAC Name | 2-(4-cyclohexylbenzene-6-id-1-yl)pyridine;2-(10,10-dithiophen-2-yl-3H-benzo[b][1,4]benzoxasilin-3-id-4-yl)pyridine;iridium |
| SMILES | [Ir].[c-]1cc(C2CCCCC2)ccc1-c1ccccn1.[c-]1ccc2c(c1-c1ccccn1)Oc1ccccc1[Si]2(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C25H16NOS2Si.C17H18N.Ir/c1-2-11-21-20(10-1)27-25-18(19-9-3-4-15-26-19)8-5-12-22(25)30(21,23-13-6-16-28-23)24-14-7-17-29-24;1-2-6-14(7-3-1)15-9-11-16(12-10-15)17-8-4-5-13-18-17;/h1-7,9-17H;4-5,8-11,13-14H,1-3,6-7H2;/q2*-1; |
| InChIKey | YJDFHCOFCQTDIS-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.18 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|