C13H14N2O2 — CID 153433085
1,3-dipyridin-4-ylpropane-1,3-diol (PubChem CID 153433085) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1,3-dipyridin-4-ylpropane-1,3-diol.
| Compound Name | 1,3-dipyridin-4-ylpropane-1,3-diol |
|---|---|
| PubChem CID | 153433085 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1,3-dipyridin-4-ylpropane-1,3-diol |
| SMILES | OC(CC(O)c1ccncc1)c1ccncc1 |
| InChI | InChI=1S/C13H14N2O2/c16-12(10-1-5-14-6-2-10)9-13(17)11-3-7-15-8-4-11/h1-8,12-13,16-17H,9H2 |
| InChIKey | YZRSBPROQBJWIF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |