C36H50IrN3O2- — CID 153433182
3,7-diethylnonane-4,6-diol;5,10-dimethyl-1-(5,6,7,8-tetrahydroisoquinolin-3-yl)-2H-phenazin-2-ide;iridium (PubChem CID 153433182) has the molecular formula C36H50IrN3O2- and a molecular weight of 749.03 g/mol. Its IUPAC name is 3,7-diethylnonane-4,6-diol;5,10-dimethyl-1-(5,6,7,8-tetrahydroisoquinolin-3-yl)-2H-phenazin-2-ide;iridium.
| Compound Name | 3,7-diethylnonane-4,6-diol;5,10-dimethyl-1-(5,6,7,8-tetrahydroisoquinolin-3-yl)-2H-phenazin-2-ide;iridium |
|---|---|
| PubChem CID | 153433182 |
| Molecular Formula | C36H50IrN3O2- |
| Molecular Weight | 749.03 g/mol |
| Exact Mass | 749.35 |
| IUPAC Name | 3,7-diethylnonane-4,6-diol;5,10-dimethyl-1-(5,6,7,8-tetrahydroisoquinolin-3-yl)-2H-phenazin-2-ide;iridium |
| SMILES | CCC(CC)C(O)CC(O)C(CC)CC.CN1c2ccccc2N(C)c2c(-c3cc4c(cn3)CCCC4)[c-]ccc21.[Ir] |
| InChI | InChI=1S/C23H22N3.C13H28O2.Ir/c1-25-20-11-5-6-12-21(20)26(2)23-18(10-7-13-22(23)25)19-14-16-8-3-4-9-17(16)15-24-19;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-7,11-15H,3-4,8-9H2,1-2H3;10-15H,5-9H2,1-4H3;/q-1;; |
| InChIKey | DKHDATBVUYSDLQ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.03 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|