About 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine
6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine (PubChem CID 153434205) has the molecular formula C20H14ClN5
and a molecular weight of 359.82 g/mol. Its IUPAC name is 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine |
| PubChem CID | 153434205 |
| Molecular Formula | C20H14ClN5 |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine |
| SMILES | [C-]#[N+]c1cnc2ccc(-c3c(-c4ccc(Cl)cc4)n[nH]c3C3CC3)cn12 |
| InChI | InChI=1S/C20H14ClN5/c1-22-17-10-23-16-9-6-14(11-26(16)17)18-19(12-2-3-12)24-25-20(18)13-4-7-15(21)8-5-13/h4-12H,2-3H2,(H,24,25) |
| InChIKey | AUNWNEYVPHELOW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 50.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine?
The IUPAC name of 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine (CID 153434205) is 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine?
The canonical SMILES for 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine is [C-]#[N+]c1cnc2ccc(-c3c(-c4ccc(Cl)cc4)n[nH]c3C3CC3)cn12.
What is the InChIKey of 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine?
The InChIKey is AUNWNEYVPHELOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14ClN5/c1-22-17-10-23-16-9-6-14(11-26(16)17)18-19(12-2-3-12)24-25-20(18)13-4-7-15(21)8-5-13/h4-12H,2-3H2,(H,24,25).
What are the key properties of 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine?
6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine has a molecular weight of 359.82 g/mol, XLogP of 5.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(4-chlorophenyl)-5-cyclopropyl-1H-pyrazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine is sourced from PubChem (CID 153434205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).