C24H36BFN2O3Si — CID 153434242
2-[[5-cyclopropyl-3-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 153434242) has the molecular formula C24H36BFN2O3Si and a molecular weight of 458.46 g/mol. Its IUPAC name is 2-[[5-cyclopropyl-3-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-cyclopropyl-3-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 153434242 |
| Molecular Formula | C24H36BFN2O3Si |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 2-[[5-cyclopropyl-3-(4-fluorophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC1(C)OB(c2c(-c3ccc(F)cc3)nn(COCC[Si](C)(C)C)c2C2CC2)OC1(C)C |
| InChI | InChI=1S/C24H36BFN2O3Si/c1-23(2)24(3,4)31-25(30-23)20-21(17-10-12-19(26)13-11-17)27-28(22(20)18-8-9-18)16-29-14-15-32(5,6)7/h10-13,18H,8-9,14-16H2,1-7H3 |
| InChIKey | VJFQHEKEHGBGNM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|