About CID 153434809
CID 153434809 (PubChem CID 153434809) has the molecular formula C65H63N4O2Si4
and a molecular weight of 1044.59 g/mol.
Molecular Properties
| Compound Name | CID 153434809 |
| PubChem CID | 153434809 |
| Molecular Formula | C65H63N4O2Si4 |
| Molecular Weight | 1044.59 g/mol |
| Exact Mass | 1043.40 |
| IUPAC Name | — |
| SMILES | C[Si](C)c1cc(-c2c(-c3ccccc3-c3cccc(-c4ccccc4-c4ccn5c(=O)c6ccccc6nc5c4-c4cc([Si](C)(C)C)cc([Si](C)(C)C)c4)c3)ccn3c(=O)c4ccccc4nc23)cc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C65H63N4O2Si4/c1-72(2)46-36-44(37-47(40-46)73(3,4)5)60-54(31-33-68-62(60)66-58-29-18-16-27-56(58)64(68)70)52-25-14-12-23-50(52)42-21-20-22-43(35-42)51-24-13-15-26-53(51)55-32-34-69-63(67-59-30-19-17-28-57(59)65(69)71)61(55)45-38-48(74(6,7)8)41-49(39-45)75(9,10)11/h12-41H,1-11H3 |
| InChIKey | YXNSETVSMRJNRO-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 68.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 75 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1044.59 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 153434809 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153434809?
The IUPAC name of CID 153434809 (CID 153434809) is not available.
What is the SMILES notation for CID 153434809?
The canonical SMILES for CID 153434809 is C[Si](C)c1cc(-c2c(-c3ccccc3-c3cccc(-c4ccccc4-c4ccn5c(=O)c6ccccc6nc5c4-c4cc([Si](C)(C)C)cc([Si](C)(C)C)c4)c3)ccn3c(=O)c4ccccc4nc23)cc([Si](C)(C)C)c1.
What is the InChIKey of CID 153434809?
The InChIKey is YXNSETVSMRJNRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C65H63N4O2Si4/c1-72(2)46-36-44(37-47(40-46)73(3,4)5)60-54(31-33-68-62(60)66-58-29-18-16-27-56(58)64(68)70)52-25-14-12-23-50(52)42-21-20-22-43(35-42)51-24-13-15-26-53(51)55-32-34-69-63(67-59-30-19-17-28-57(59)65(69)71)61(55)45-38-48(74(6,7)8)41-49(39-45)75(9,10)11/h12-41H,1-11H3.
What are the key properties of CID 153434809?
CID 153434809 has a molecular weight of 1044.59 g/mol, XLogP of 13.61, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153434809 is sourced from PubChem (CID 153434809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).