C28H56O2 — CID 153434814
methyl (9R,10R,11R,12S,13S,14R,15S,16R)-9,10,11,12,13,14,15,16,17-nonamethyloctadecanoate (PubChem CID 153434814) has the molecular formula C28H56O2 and a molecular weight of 424.75 g/mol. Its IUPAC name is methyl (9R,10R,11R,12S,13S,14R,15S,16R)-9,10,11,12,13,14,15,16,17-nonamethyloctadecanoate.
| Compound Name | methyl (9R,10R,11R,12S,13S,14R,15S,16R)-9,10,11,12,13,14,15,16,17-nonamethyloctadecanoate |
|---|---|
| PubChem CID | 153434814 |
| Molecular Formula | C28H56O2 |
| Molecular Weight | 424.75 g/mol |
| Exact Mass | 424.43 |
| IUPAC Name | methyl (9R,10R,11R,12S,13S,14R,15S,16R)-9,10,11,12,13,14,15,16,17-nonamethyloctadecanoate |
| SMILES | COC(=O)CCCCCCC[C@@H](C)[C@@H](C)[C@@H](C)[C@H](C)[C@@H](C)[C@H](C)[C@@H](C)[C@H](C)C(C)C |
| InChI | InChI=1S/C28H56O2/c1-19(2)21(4)23(6)25(8)27(10)26(9)24(7)22(5)20(3)17-15-13-12-14-16-18-28(29)30-11/h19-27H,12-18H2,1-11H3/t20-,21-,22-,23+,24-,25-,26+,27+/m1/s1 |
| InChIKey | RHEBINWPSUTXIV-WRLGOBHPSA-N |
| XLogP | 8.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.75 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|