About (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate
(4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate (PubChem CID 153434860) has the molecular formula C5H6N2O4
and a molecular weight of 158.11 g/mol. Its IUPAC name is (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate.
Molecular Properties
| Compound Name | (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate |
| PubChem CID | 153434860 |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate |
| SMILES | COc1nonc1COC=O |
| InChI | InChI=1S/C5H6N2O4/c1-9-5-4(2-10-3-8)6-11-7-5/h3H,2H2,1H3 |
| InChIKey | NZGSVLBBRXDSIM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate?
The IUPAC name of (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate (CID 153434860) is (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate.
What is the SMILES notation for (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate?
The canonical SMILES for (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate is COc1nonc1COC=O.
What is the InChIKey of (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate?
The InChIKey is NZGSVLBBRXDSIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O4/c1-9-5-4(2-10-3-8)6-11-7-5/h3H,2H2,1H3.
What are the key properties of (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate?
(4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate has a molecular weight of 158.11 g/mol, XLogP of -0.25, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-1,2,5-oxadiazol-3-yl)methyl formate is sourced from PubChem (CID 153434860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).