C17H18F3N3S — CID 153435221
1,1,1-trifluoro-4-imino-4-[4-[4-(2-methylpropyl)thiophen-3-yl]-2-pyridinyl]but-2-en-2-amine (PubChem CID 153435221) has the molecular formula C17H18F3N3S and a molecular weight of 353.41 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-imino-4-[4-[4-(2-methylpropyl)thiophen-3-yl]-2-pyridinyl]but-2-en-2-amine.
| Compound Name | 1,1,1-trifluoro-4-imino-4-[4-[4-(2-methylpropyl)thiophen-3-yl]-2-pyridinyl]but-2-en-2-amine |
|---|---|
| PubChem CID | 153435221 |
| Molecular Formula | C17H18F3N3S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1,1,1-trifluoro-4-imino-4-[4-[4-(2-methylpropyl)thiophen-3-yl]-2-pyridinyl]but-2-en-2-amine |
| SMILES | [H]/N=C(\C=C(N)C(F)(F)F)c1cc(-c2cscc2CC(C)C)ccn1 |
| InChI | InChI=1S/C17H18F3N3S/c1-10(2)5-12-8-24-9-13(12)11-3-4-23-15(6-11)14(21)7-16(22)17(18,19)20/h3-4,6-10,21H,5,22H2,1-2H3/b16-7?,21-14+ |
| InChIKey | IORGCCKHDLABBA-KHMROYPLSA-N |
| XLogP | 4.78 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|