C43H29N5 — CID 153435459
2-[3-[3-[4-(3-phenylphenyl)phenyl]phenyl]phenyl]-4,6-dipyridin-3-yl-1,3,5-triazine (PubChem CID 153435459) has the molecular formula C43H29N5 and a molecular weight of 615.74 g/mol. Its IUPAC name is 2-[3-[3-[4-(3-phenylphenyl)phenyl]phenyl]phenyl]-4,6-dipyridin-3-yl-1,3,5-triazine.
| Compound Name | 2-[3-[3-[4-(3-phenylphenyl)phenyl]phenyl]phenyl]-4,6-dipyridin-3-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 153435459 |
| Molecular Formula | C43H29N5 |
| Molecular Weight | 615.74 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | 2-[3-[3-[4-(3-phenylphenyl)phenyl]phenyl]phenyl]-4,6-dipyridin-3-yl-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3ccc(-c4cccc(-c5cccc(-c6nc(-c7cccnc7)nc(-c7cccnc7)n6)c5)c4)cc3)c2)cc1 |
| InChI | InChI=1S/C43H29N5/c1-2-9-30(10-3-1)33-11-4-12-34(25-33)31-19-21-32(22-20-31)35-13-5-14-36(26-35)37-15-6-16-38(27-37)41-46-42(39-17-7-23-44-28-39)48-43(47-41)40-18-8-24-45-29-40/h1-29H |
| InChIKey | QQBZZGMFQJBBRK-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.74 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |