About 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium
5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium (PubChem CID 153435530) has the molecular formula C30H24FIrN2-
and a molecular weight of 623.75 g/mol. Its IUPAC name is 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium.
Molecular Properties
| Compound Name | 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium |
| PubChem CID | 153435530 |
| Molecular Formula | C30H24FIrN2- |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium |
| SMILES | CC(C)c1cc(-c2ccccc2)c(-c2ccnn2-c2[c-]cc(F)cc2)c(-c2ccccc2)c1.[Ir] |
| InChI | InChI=1S/C30H24FN2.Ir/c1-21(2)24-19-27(22-9-5-3-6-10-22)30(28(20-24)23-11-7-4-8-12-23)29-17-18-32-33(29)26-15-13-25(31)14-16-26;/h3-15,17-21H,1-2H3;/q-1; |
| InChIKey | RFWROTLSRFFNPV-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium?
The IUPAC name of 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium (CID 153435530) is 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium.
What is the SMILES notation for 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium?
The canonical SMILES for 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium is CC(C)c1cc(-c2ccccc2)c(-c2ccnn2-c2[c-]cc(F)cc2)c(-c2ccccc2)c1.[Ir].
What is the InChIKey of 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium?
The InChIKey is RFWROTLSRFFNPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24FN2.Ir/c1-21(2)24-19-27(22-9-5-3-6-10-22)30(28(20-24)23-11-7-4-8-12-23)29-17-18-32-33(29)26-15-13-25(31)14-16-26;/h3-15,17-21H,1-2H3;/q-1;.
What are the key properties of 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium?
5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium has a molecular weight of 623.75 g/mol, XLogP of 7.93, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-diphenyl-4-propan-2-ylphenyl)-1-(4-fluorobenzene-6-id-1-yl)pyrazole;iridium is sourced from PubChem (CID 153435530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).