C23H16ClFN4O4S — CID 153436234
[(1S,2R)-2-[[5-fluoro-2-(7-isocyano-2-methoxyquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]cyclopentyl] carbonochloridate (PubChem CID 153436234) has the molecular formula C23H16ClFN4O4S and a molecular weight of 498.92 g/mol. Its IUPAC name is [(1S,2R)-2-[[5-fluoro-2-(7-isocyano-2-methoxyquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]cyclopentyl] carbonochloridate.
| Compound Name | [(1S,2R)-2-[[5-fluoro-2-(7-isocyano-2-methoxyquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]cyclopentyl] carbonochloridate |
|---|---|
| PubChem CID | 153436234 |
| Molecular Formula | C23H16ClFN4O4S |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | [(1S,2R)-2-[[5-fluoro-2-(7-isocyano-2-methoxyquinoxalin-5-yl)-1,3-benzothiazol-6-yl]oxy]cyclopentyl] carbonochloridate |
| SMILES | [C-]#[N+]c1cc(-c2nc3cc(F)c(O[C@@H]4CCC[C@@H]4OC(=O)Cl)cc3s2)c2ncc(OC)nc2c1 |
| InChI | InChI=1S/C23H16ClFN4O4S/c1-26-11-6-12(21-15(7-11)28-20(31-2)10-27-21)22-29-14-8-13(25)18(9-19(14)34-22)32-16-4-3-5-17(16)33-23(24)30/h6-10,16-17H,3-5H2,2H3/t16-,17+/m1/s1 |
| InChIKey | UCYLBGVGTJTONP-SJORKVTESA-N |
| XLogP | 6.28 |
| TPSA | 87.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|