C20H21BN4O2 — CID 153436818
3-isocyano-2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (PubChem CID 153436818) has the molecular formula C20H21BN4O2 and a molecular weight of 360.23 g/mol. Its IUPAC name is 3-isocyano-2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline.
| Compound Name | 3-isocyano-2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 153436818 |
| Molecular Formula | C20H21BN4O2 |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3-isocyano-2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| SMILES | [C-]#[N+]c1cc2c(B3OC(C)(C)C(C)(C)O3)cccc2nc1-c1cnn(C)c1 |
| InChI | InChI=1S/C20H21BN4O2/c1-19(2)20(3,4)27-21(26-19)15-8-7-9-16-14(15)10-17(22-5)18(24-16)13-11-23-25(6)12-13/h7-12H,1-4,6H3 |
| InChIKey | AFGYGUPLRWFPHH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|