About 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one
1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one (PubChem CID 153436952) has the molecular formula C17H32O4
and a molecular weight of 300.44 g/mol. Its IUPAC name is 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one |
| PubChem CID | 153436952 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)/C=C/COCCOCCOCC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H32O4/c1-16(2,3)8-7-9-19-10-11-20-12-13-21-14-15(18)17(4,5)6/h7-8H,9-14H2,1-6H3/b8-7+ |
| InChIKey | GCFKIKICJSFQLA-BQYQJAHWSA-N |
| XLogP | 3.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one?
The IUPAC name of 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one (CID 153436952) is 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one is CC(C)(C)/C=C/COCCOCCOCC(=O)C(C)(C)C.
What is the InChIKey of 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one?
The InChIKey is GCFKIKICJSFQLA-BQYQJAHWSA-N. The full InChI is InChI=1S/C17H32O4/c1-16(2,3)8-7-9-19-10-11-20-12-13-21-14-15(18)17(4,5)6/h7-8H,9-14H2,1-6H3/b8-7+.
What are the key properties of 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one?
1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one has a molecular weight of 300.44 g/mol, XLogP of 3.25, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-[(E)-4,4-dimethylpent-2-enoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-one is sourced from PubChem (CID 153436952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).