C42H38N6O2 — CID 153437694
14-[(4-methoxyphenyl)methyl]-8-(oxan-4-yl)-4-trityl-4,5,8,10,14,15-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(15),2,5,9,11,13(16)-hexaene (PubChem CID 153437694) has the molecular formula C42H38N6O2 and a molecular weight of 658.81 g/mol. Its IUPAC name is 14-[(4-methoxyphenyl)methyl]-8-(oxan-4-yl)-4-trityl-4,5,8,10,14,15-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(15),2,5,9,11,13(16)-hexaene.
| Compound Name | 14-[(4-methoxyphenyl)methyl]-8-(oxan-4-yl)-4-trityl-4,5,8,10,14,15-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(15),2,5,9,11,13(16)-hexaene |
|---|---|
| PubChem CID | 153437694 |
| Molecular Formula | C42H38N6O2 |
| Molecular Weight | 658.81 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | 14-[(4-methoxyphenyl)methyl]-8-(oxan-4-yl)-4-trityl-4,5,8,10,14,15-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(15),2,5,9,11,13(16)-hexaene |
| SMILES | COc1ccc(Cn2nc3c4c(nccc42)N(C2CCOCC2)Cc2nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cc2-3)cc1 |
| InChI | InChI=1S/C42H38N6O2/c1-49-35-19-17-30(18-20-35)27-47-38-21-24-43-41-39(38)40(45-47)36-28-48(44-37(36)29-46(41)34-22-25-50-26-23-34)42(31-11-5-2-6-12-31,32-13-7-3-8-14-32)33-15-9-4-10-16-33/h2-21,24,28,34H,22-23,25-27,29H2,1H3 |
| InChIKey | ACVZLKURPPZVCX-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 70.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.81 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|