C26H46O5Si — CID 15343855
(1E,3R,9R,10R,11S,14R)-6-[2-(methoxymethoxy)propan-2-yl]-14-(methoxymethyl)-3,10-dimethyl-14-trimethylsilyloxytricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-ol (PubChem CID 15343855) has the molecular formula C26H46O5Si and a molecular weight of 466.74 g/mol. Its IUPAC name is (1E,3R,9R,10R,11S,14R)-6-[2-(methoxymethoxy)propan-2-yl]-14-(methoxymethyl)-3,10-dimethyl-14-trimethylsilyloxytricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-ol.
| Compound Name | (1E,3R,9R,10R,11S,14R)-6-[2-(methoxymethoxy)propan-2-yl]-14-(methoxymethyl)-3,10-dimethyl-14-trimethylsilyloxytricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-ol |
|---|---|
| PubChem CID | 15343855 |
| Molecular Formula | C26H46O5Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | (1E,3R,9R,10R,11S,14R)-6-[2-(methoxymethoxy)propan-2-yl]-14-(methoxymethyl)-3,10-dimethyl-14-trimethylsilyloxytricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-ol |
| SMILES | COCOC(C)(C)C1=C2C[C@@H](O)[C@H](C)[C@@H]3CC[C@@](COC)(O[Si](C)(C)C)/C3=C/[C@@]2(C)CC1 |
| InChI | InChI=1S/C26H46O5Si/c1-18-19-10-13-26(16-28-5,31-32(7,8)9)22(19)15-25(4)12-11-20(21(25)14-23(18)27)24(2,3)30-17-29-6/h15,18-19,23,27H,10-14,16-17H2,1-9H3/b22-15+/t18-,19+,23-,25-,26+/m1/s1 |
| InChIKey | DXAPMIRGBOTAAR-LJZOJCTPSA-N |
| XLogP | 5.46 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|