C19H23N5O2 — CID 153438794
[(4R)-4-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]methanone (PubChem CID 153438794) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is [(4R)-4-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]methanone.
| Compound Name | [(4R)-4-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 153438794 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | [(4R)-4-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(NCc2cccnc2)nc1)N1CC2CCC[C@@H](O)C2C1 |
| InChI | InChI=1S/C19H23N5O2/c25-17-5-1-4-14-11-24(12-16(14)17)18(26)15-9-22-19(23-10-15)21-8-13-3-2-6-20-7-13/h2-3,6-7,9-10,14,16-17,25H,1,4-5,8,11-12H2,(H,21,22,23)/t14?,16?,17-/m1/s1 |
| InChIKey | MVYRLQOZJDSYLT-BDVYOWHSSA-N |
| XLogP | 1.72 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |