C20H24O4 — CID 15343889
(1S,7R,10R,11S,12S,13R,14S)-14-acetyl-10-ethenyl-9,9,11-trimethyl-2-oxatetracyclo[9.2.1.04,13.07,12]tetradec-4-ene-3,8-dione (PubChem CID 15343889) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (1S,7R,10R,11S,12S,13R,14S)-14-acetyl-10-ethenyl-9,9,11-trimethyl-2-oxatetracyclo[9.2.1.04,13.07,12]tetradec-4-ene-3,8-dione.
| Compound Name | (1S,7R,10R,11S,12S,13R,14S)-14-acetyl-10-ethenyl-9,9,11-trimethyl-2-oxatetracyclo[9.2.1.04,13.07,12]tetradec-4-ene-3,8-dione |
|---|---|
| PubChem CID | 15343889 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1S,7R,10R,11S,12S,13R,14S)-14-acetyl-10-ethenyl-9,9,11-trimethyl-2-oxatetracyclo[9.2.1.04,13.07,12]tetradec-4-ene-3,8-dione |
| SMILES | C=C[C@H]1C(C)(C)C(=O)[C@@H]2CC=C3C(=O)O[C@H]4[C@@H]3[C@@H]2[C@]1(C)[C@@H]4C(C)=O |
| InChI | InChI=1S/C20H24O4/c1-6-12-19(3,4)17(22)11-8-7-10-13-15(11)20(12,5)14(9(2)21)16(13)24-18(10)23/h6-7,11-16H,1,8H2,2-5H3/t11-,12+,13+,14-,15-,16+,20+/m1/s1 |
| InChIKey | XBHFSRRXPYMPED-VUTIQODZSA-N |
| XLogP | 2.73 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|