C54H54IrN3O6 — CID 153438927
iridium(3+);tris[2-(2-methylpropyl)-4-pyridin-2-ylbenzene-5-id-1-yl] cyclohexane-1,3,5-tricarboxylate (PubChem CID 153438927) has the molecular formula C54H54IrN3O6 and a molecular weight of 1033.26 g/mol. Its IUPAC name is iridium(3+);tris[2-(2-methylpropyl)-4-pyridin-2-ylbenzene-5-id-1-yl] cyclohexane-1,3,5-tricarboxylate.
| Compound Name | iridium(3+);tris[2-(2-methylpropyl)-4-pyridin-2-ylbenzene-5-id-1-yl] cyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 153438927 |
| Molecular Formula | C54H54IrN3O6 |
| Molecular Weight | 1033.26 g/mol |
| Exact Mass | 1033.36 |
| IUPAC Name | iridium(3+);tris[2-(2-methylpropyl)-4-pyridin-2-ylbenzene-5-id-1-yl] cyclohexane-1,3,5-tricarboxylate |
| SMILES | CC(C)Cc1cc(-c2ccccn2)[c-]cc1OC(=O)C1CC(C(=O)Oc2c[c-]c(-c3ccccn3)cc2CC(C)C)CC(C(=O)Oc2c[c-]c(-c3ccccn3)cc2CC(C)C)C1.[Ir+3] |
| InChI | InChI=1S/C54H54N3O6.Ir/c1-34(2)25-40-28-37(46-13-7-10-22-55-46)16-19-49(40)61-52(58)43-31-44(53(59)62-50-20-17-38(29-41(50)26-35(3)4)47-14-8-11-23-56-47)33-45(32-43)54(60)63-51-21-18-39(30-42(51)27-36(5)6)48-15-9-12-24-57-48;/h7-15,19-24,28-30,34-36,43-45H,25-27,31-33H2,1-6H3;/q-3;+3 |
| InChIKey | QRBUGODEGQVIDY-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.26 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|