About methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine
methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine (PubChem CID 153439808) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine.
Molecular Properties
| Compound Name | methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine |
| PubChem CID | 153439808 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine |
| SMILES | COC(N)C1=CCCN(C)C1 |
| InChI | InChI=1S/C8H16N2O/c1-10-5-3-4-7(6-10)8(9)11-2/h4,8H,3,5-6,9H2,1-2H3 |
| InChIKey | MCHHHSZGILQSEF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine?
The IUPAC name of methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine (CID 153439808) is methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine.
What is the SMILES notation for methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine?
The canonical SMILES for methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine is COC(N)C1=CCCN(C)C1.
What is the InChIKey of methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine?
The InChIKey is MCHHHSZGILQSEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-10-5-3-4-7(6-10)8(9)11-2/h4,8H,3,5-6,9H2,1-2H3.
What are the key properties of methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine?
methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine has a molecular weight of 156.23 g/mol, XLogP of 0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methanamine is sourced from PubChem (CID 153439808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).