C46H50N4O — CID 153441018
6-(3,3-dimethylbutan-2-yl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-pentylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole (PubChem CID 153441018) has the molecular formula C46H50N4O and a molecular weight of 674.93 g/mol. Its IUPAC name is 6-(3,3-dimethylbutan-2-yl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-pentylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole.
| Compound Name | 6-(3,3-dimethylbutan-2-yl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-pentylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 153441018 |
| Molecular Formula | C46H50N4O |
| Molecular Weight | 674.93 g/mol |
| Exact Mass | 674.40 |
| IUPAC Name | 6-(3,3-dimethylbutan-2-yl)-2-[3-(3,5-dimethyl-4-phenylpyrazol-1-yl)-5-pentylphenoxy]-9-(4-methyl-2-pyridinyl)carbazole |
| SMILES | CCCCCc1cc(Oc2ccc3c4cc(C(C)C(C)(C)C)ccc4n(-c4cc(C)ccn4)c3c2)cc(-n2nc(C)c(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C46H50N4O/c1-9-10-12-15-34-25-37(50-33(5)45(32(4)48-50)35-16-13-11-14-17-35)28-39(26-34)51-38-19-20-40-41-27-36(31(3)46(6,7)8)18-21-42(41)49(43(40)29-38)44-24-30(2)22-23-47-44/h11,13-14,16-29,31H,9-10,12,15H2,1-8H3 |
| InChIKey | YNMQAUMMGRHOMU-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.93 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|