C18H22O2 — CID 15344130
1-(1,2,10-trimethyl-9-oxatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-trien-5-yl)ethanone (PubChem CID 15344130) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-(1,2,10-trimethyl-9-oxatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-trien-5-yl)ethanone.
| Compound Name | 1-(1,2,10-trimethyl-9-oxatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-trien-5-yl)ethanone |
|---|---|
| PubChem CID | 15344130 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-(1,2,10-trimethyl-9-oxatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-trien-5-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)C1(C)C3(C)CCC(C3)C1(C)O2 |
| InChI | InChI=1S/C18H22O2/c1-11(19)12-5-6-15-14(9-12)17(3)16(2)8-7-13(10-16)18(17,4)20-15/h5-6,9,13H,7-8,10H2,1-4H3 |
| InChIKey | CIDZZTMQXAQLTK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |