About 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde
3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde (PubChem CID 15344155) has the molecular formula C20H38O2
and a molecular weight of 310.52 g/mol. Its IUPAC name is 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde.
Molecular Properties
| Compound Name | 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde |
| PubChem CID | 15344155 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC1(C)OC1C=O |
| InChI | InChI=1S/C20H38O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-20(5)19(15-21)22-20/h15-19H,6-14H2,1-5H3 |
| InChIKey | AOIAAMJHUQTJKQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde?
The IUPAC name of 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde (CID 15344155) is 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde.
What is the SMILES notation for 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde?
The canonical SMILES for 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde is CC(C)CCCC(C)CCCC(C)CCCC1(C)OC1C=O.
What is the InChIKey of 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde?
The InChIKey is AOIAAMJHUQTJKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-20(5)19(15-21)22-20/h15-19H,6-14H2,1-5H3.
What are the key properties of 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde?
3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde has a molecular weight of 310.52 g/mol, XLogP of 5.78, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-(4,8,12-trimethyltridecyl)oxirane-2-carbaldehyde is sourced from PubChem (CID 15344155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).