C14H24O4 — CID 15344389
(1R,2S,3S,4R)-2-[(2E)-hexa-2,5-dien-2-yl]-1-(hydroxymethyl)-3-methoxycyclohexane-1,4-diol (PubChem CID 15344389) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (1R,2S,3S,4R)-2-[(2E)-hexa-2,5-dien-2-yl]-1-(hydroxymethyl)-3-methoxycyclohexane-1,4-diol.
| Compound Name | (1R,2S,3S,4R)-2-[(2E)-hexa-2,5-dien-2-yl]-1-(hydroxymethyl)-3-methoxycyclohexane-1,4-diol |
|---|---|
| PubChem CID | 15344389 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (1R,2S,3S,4R)-2-[(2E)-hexa-2,5-dien-2-yl]-1-(hydroxymethyl)-3-methoxycyclohexane-1,4-diol |
| SMILES | C=CC/C=C(\C)[C@H]1[C@H](OC)[C@H](O)CC[C@]1(O)CO |
| InChI | InChI=1S/C14H24O4/c1-4-5-6-10(2)12-13(18-3)11(16)7-8-14(12,17)9-15/h4,6,11-13,15-17H,1,5,7-9H2,2-3H3/b10-6+/t11-,12+,13-,14+/m1/s1 |
| InChIKey | DDWSDXQHBDIKGM-OTTGTSSWSA-N |
| XLogP | 1.02 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|