C36H51N7O8S2 — CID 153443984
1-[(2R)-3-cyclohexyl-2-[(4-propan-2-ylsulfonylbenzoyl)amino]propanoyl]-4-[5-(2-hydroxypropan-2-yl)triazol-1-yl]-N-(4-oxamoylthian-4-yl)pyrrolidine-2-carboxamide (PubChem CID 153443984) has the molecular formula C36H51N7O8S2 and a molecular weight of 773.98 g/mol. Its IUPAC name is 1-[(2R)-3-cyclohexyl-2-[(4-propan-2-ylsulfonylbenzoyl)amino]propanoyl]-4-[5-(2-hydroxypropan-2-yl)triazol-1-yl]-N-(4-oxamoylthian-4-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2R)-3-cyclohexyl-2-[(4-propan-2-ylsulfonylbenzoyl)amino]propanoyl]-4-[5-(2-hydroxypropan-2-yl)triazol-1-yl]-N-(4-oxamoylthian-4-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 153443984 |
| Molecular Formula | C36H51N7O8S2 |
| Molecular Weight | 773.98 g/mol |
| Exact Mass | 773.32 |
| IUPAC Name | 1-[(2R)-3-cyclohexyl-2-[(4-propan-2-ylsulfonylbenzoyl)amino]propanoyl]-4-[5-(2-hydroxypropan-2-yl)triazol-1-yl]-N-(4-oxamoylthian-4-yl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)S(=O)(=O)c1ccc(C(=O)N[C@H](CC2CCCCC2)C(=O)N2CC(n3nncc3C(C)(C)O)CC2C(=O)NC2(C(=O)C(N)=O)CCSCC2)cc1 |
| InChI | InChI=1S/C36H51N7O8S2/c1-22(2)53(50,51)26-12-10-24(11-13-26)32(46)39-27(18-23-8-6-5-7-9-23)34(48)42-21-25(43-29(20-38-41-43)35(3,4)49)19-28(42)33(47)40-36(30(44)31(37)45)14-16-52-17-15-36/h10-13,20,22-23,25,27-28,49H,5-9,14-19,21H2,1-4H3,(H2,37,45)(H,39,46)(H,40,47)/t25?,27-,28?/m1/s1 |
| InChIKey | JWECCSATAWSNMM-YVVHSEAESA-N |
| XLogP | 2.04 |
| TPSA | 223.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.98 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|