C27H35F3N6O2 — CID 153444719
(7S)-4,8-dimethyl-2-[[3-[oxolan-3-ylmethyl-[(3,4,5-trifluorophenyl)methyl]amino]cyclobutyl]amino]-7-propan-2-yl-5,7-dihydropteridin-6-one (PubChem CID 153444719) has the molecular formula C27H35F3N6O2 and a molecular weight of 532.61 g/mol. Its IUPAC name is (7S)-4,8-dimethyl-2-[[3-[oxolan-3-ylmethyl-[(3,4,5-trifluorophenyl)methyl]amino]cyclobutyl]amino]-7-propan-2-yl-5,7-dihydropteridin-6-one.
| Compound Name | (7S)-4,8-dimethyl-2-[[3-[oxolan-3-ylmethyl-[(3,4,5-trifluorophenyl)methyl]amino]cyclobutyl]amino]-7-propan-2-yl-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 153444719 |
| Molecular Formula | C27H35F3N6O2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | (7S)-4,8-dimethyl-2-[[3-[oxolan-3-ylmethyl-[(3,4,5-trifluorophenyl)methyl]amino]cyclobutyl]amino]-7-propan-2-yl-5,7-dihydropteridin-6-one |
| SMILES | Cc1nc(NC2CC(N(Cc3cc(F)c(F)c(F)c3)CC3CCOC3)C2)nc2c1NC(=O)[C@H](C(C)C)N2C |
| InChI | InChI=1S/C27H35F3N6O2/c1-14(2)24-26(37)33-23-15(3)31-27(34-25(23)35(24)4)32-18-9-19(10-18)36(11-16-5-6-38-13-16)12-17-7-20(28)22(30)21(29)8-17/h7-8,14,16,18-19,24H,5-6,9-13H2,1-4H3,(H,33,37)(H,31,32,34)/t16?,18?,19?,24-/m0/s1 |
| InChIKey | NAWCXHVTEPTSQY-PHSHBYBOSA-N |
| XLogP | 4.10 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|