C40H41F11O9 — CID 153445111
1-O-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-(2-methylbutanoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl] 5-O-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl] 2-ethyl-4-methylpentanedioate (PubChem CID 153445111) has the molecular formula C40H41F11O9 and a molecular weight of 874.74 g/mol. Its IUPAC name is 1-O-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-(2-methylbutanoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl] 5-O-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl] 2-ethyl-4-methylpentanedioate.
| Compound Name | 1-O-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-(2-methylbutanoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl] 5-O-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl] 2-ethyl-4-methylpentanedioate |
|---|---|
| PubChem CID | 153445111 |
| Molecular Formula | C40H41F11O9 |
| Molecular Weight | 874.74 g/mol |
| Exact Mass | 874.26 |
| IUPAC Name | 1-O-[2-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-(2-methylbutanoyloxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethyl] 5-O-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl] 2-ethyl-4-methylpentanedioate |
| SMILES | CCC(C)C(=O)OCCOc1ccc(C(c2ccc(OCCOC(=O)C(CC)CC(C)C(=O)OCCOc3c(F)c(F)c(F)c(F)c3F)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C40H41F11O9/c1-5-22(3)35(52)58-18-15-55-27-11-7-25(8-12-27)38(39(46,47)48,40(49,50)51)26-9-13-28(14-10-26)56-16-19-60-37(54)24(6-2)21-23(4)36(53)59-20-17-57-34-32(44)30(42)29(41)31(43)33(34)45/h7-14,22-24H,5-6,15-21H2,1-4H3 |
| InChIKey | PTPHTRUMFLGDAD-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.74 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|