About (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one
(4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one (PubChem CID 153445193) has the molecular formula C14H26F3NO
and a molecular weight of 281.36 g/mol. Its IUPAC name is (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one.
Molecular Properties
| Compound Name | (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one |
| PubChem CID | 153445193 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one |
| SMILES | CCN(CC)CCC[C@H](C(=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H26F3NO/c1-6-18(7-2)10-8-9-11(14(15,16)17)12(19)13(3,4)5/h11H,6-10H2,1-5H3/t11-/m1/s1 |
| InChIKey | FYHOIVLFDHADKT-LLVKDONJSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one?
The IUPAC name of (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one (CID 153445193) is (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one.
What is the SMILES notation for (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one?
The canonical SMILES for (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one is CCN(CC)CCC[C@H](C(=O)C(C)(C)C)C(F)(F)F.
What is the InChIKey of (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one?
The InChIKey is FYHOIVLFDHADKT-LLVKDONJSA-N. The full InChI is InChI=1S/C14H26F3NO/c1-6-18(7-2)10-8-9-11(14(15,16)17)12(19)13(3,4)5/h11H,6-10H2,1-5H3/t11-/m1/s1.
What are the key properties of (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one?
(4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one has a molecular weight of 281.36 g/mol, XLogP of 3.90, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-7-(diethylamino)-2,2-dimethyl-4-(trifluoromethyl)heptan-3-one is sourced from PubChem (CID 153445193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).