About azepane-4,4-diol
azepane-4,4-diol (PubChem CID 153445215) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is azepane-4,4-diol.
Molecular Properties
| Compound Name | azepane-4,4-diol |
| PubChem CID | 153445215 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | azepane-4,4-diol |
| SMILES | OC1(O)CCCNCC1 |
| InChI | InChI=1S/C6H13NO2/c8-6(9)2-1-4-7-5-3-6/h7-9H,1-5H2 |
| InChIKey | XJIYOSKFVFSEAH-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze azepane-4,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepane-4,4-diol?
The IUPAC name of azepane-4,4-diol (CID 153445215) is azepane-4,4-diol.
What is the SMILES notation for azepane-4,4-diol?
The canonical SMILES for azepane-4,4-diol is OC1(O)CCCNCC1.
What is the InChIKey of azepane-4,4-diol?
The InChIKey is XJIYOSKFVFSEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c8-6(9)2-1-4-7-5-3-6/h7-9H,1-5H2.
What are the key properties of azepane-4,4-diol?
azepane-4,4-diol has a molecular weight of 131.18 g/mol, XLogP of -0.56, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azepane-4,4-diol is sourced from PubChem (CID 153445215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).