C30H28BrN — CID 153445557
6-bromo-9,9,10,10-tetramethyl-N,N-diphenylanthracen-2-amine (PubChem CID 153445557) has the molecular formula C30H28BrN and a molecular weight of 482.47 g/mol. Its IUPAC name is 6-bromo-9,9,10,10-tetramethyl-N,N-diphenylanthracen-2-amine.
| Compound Name | 6-bromo-9,9,10,10-tetramethyl-N,N-diphenylanthracen-2-amine |
|---|---|
| PubChem CID | 153445557 |
| Molecular Formula | C30H28BrN |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 6-bromo-9,9,10,10-tetramethyl-N,N-diphenylanthracen-2-amine |
| SMILES | CC1(C)c2ccc(N(c3ccccc3)c3ccccc3)cc2C(C)(C)c2ccc(Br)cc21 |
| InChI | InChI=1S/C30H28BrN/c1-29(2)26-18-16-24(20-28(26)30(3,4)25-17-15-21(31)19-27(25)29)32(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-20H,1-4H3 |
| InChIKey | PVRNBIMYVMZIRF-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |