C22H19BN2O8P+ — CID 153446246
CID 153446246 (PubChem CID 153446246) has the molecular formula C22H19BN2O8P+ and a molecular weight of 481.19 g/mol.
| Compound Name | CID 153446246 |
|---|---|
| PubChem CID | 153446246 |
| Molecular Formula | C22H19BN2O8P+ |
| Molecular Weight | 481.19 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | — |
| SMILES | [B][P+](C=C)(OCc1cc(OCC#C)ccc1[N+](=O)[O-])OCc1cc(OCC#C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19BN2O8P/c1-4-11-30-19-7-9-21(24(26)27)17(13-19)15-32-34(23,6-3)33-16-18-14-20(31-12-5-2)8-10-22(18)25(28)29/h1-2,6-10,13-14H,3,11-12,15-16H2/q+1 |
| InChIKey | FMOWLGJXERVIJZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 123.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|