About CID 153446246
CID 153446246 (PubChem CID 153446246) has the molecular formula C22H19BN2O8P+
and a molecular weight of 481.19 g/mol.
Molecular Properties
| Compound Name | CID 153446246 |
| PubChem CID | 153446246 |
| Molecular Formula | C22H19BN2O8P+ |
| Molecular Weight | 481.19 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | — |
| SMILES | [B][P+](C=C)(OCc1cc(OCC#C)ccc1[N+](=O)[O-])OCc1cc(OCC#C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19BN2O8P/c1-4-11-30-19-7-9-21(24(26)27)17(13-19)15-32-34(23,6-3)33-16-18-14-20(31-12-5-2)8-10-22(18)25(28)29/h1-2,6-10,13-14H,3,11-12,15-16H2/q+1 |
| InChIKey | FMOWLGJXERVIJZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 123.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 153446246 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153446246?
The IUPAC name of CID 153446246 (CID 153446246) is not available.
What is the SMILES notation for CID 153446246?
The canonical SMILES for CID 153446246 is [B][P+](C=C)(OCc1cc(OCC#C)ccc1[N+](=O)[O-])OCc1cc(OCC#C)ccc1[N+](=O)[O-].
What is the InChIKey of CID 153446246?
The InChIKey is FMOWLGJXERVIJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19BN2O8P/c1-4-11-30-19-7-9-21(24(26)27)17(13-19)15-32-34(23,6-3)33-16-18-14-20(31-12-5-2)8-10-22(18)25(28)29/h1-2,6-10,13-14H,3,11-12,15-16H2/q+1.
What are the key properties of CID 153446246?
CID 153446246 has a molecular weight of 481.19 g/mol, XLogP of 4.34, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153446246 is sourced from PubChem (CID 153446246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).