C23H19N3O4 — CID 153446459
[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]-[4-(4-isocyanophenyl)piperidin-1-yl]methanone (PubChem CID 153446459) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is [5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]-[4-(4-isocyanophenyl)piperidin-1-yl]methanone.
| Compound Name | [5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]-[4-(4-isocyanophenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 153446459 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]-[4-(4-isocyanophenyl)piperidin-1-yl]methanone |
| SMILES | [C-]#[N+]c1ccc(C2CCN(C(=O)c3cc(-c4ccc5c(c4)OCO5)on3)CC2)cc1 |
| InChI | InChI=1S/C23H19N3O4/c1-24-18-5-2-15(3-6-18)16-8-10-26(11-9-16)23(27)19-13-21(30-25-19)17-4-7-20-22(12-17)29-14-28-20/h2-7,12-13,16H,8-11,14H2 |
| InChIKey | FAARQKNPLWIKRN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|