About 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one
3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one (PubChem CID 153446743) has the molecular formula C6H6N2O
and a molecular weight of 122.13 g/mol. Its IUPAC name is 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one.
Molecular Properties
| Compound Name | 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one |
| PubChem CID | 153446743 |
| Molecular Formula | C6H6N2O |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one |
| SMILES | O=C1NC=C2CCN=C12 |
| InChI | InChI=1S/C6H6N2O/c9-6-5-4(3-8-6)1-2-7-5/h3H,1-2H2,(H,8,9) |
| InChIKey | SHAPPLMILHKUIB-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one?
The IUPAC name of 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one (CID 153446743) is 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one.
What is the SMILES notation for 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one?
The canonical SMILES for 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one is O=C1NC=C2CCN=C12.
What is the InChIKey of 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one?
The InChIKey is SHAPPLMILHKUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O/c9-6-5-4(3-8-6)1-2-7-5/h3H,1-2H2,(H,8,9).
What are the key properties of 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one?
3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one has a molecular weight of 122.13 g/mol, XLogP of -0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydro-2H-pyrrolo[2,3-c]pyrrol-6-one is sourced from PubChem (CID 153446743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).