C27H30IrNO3- — CID 153447006
2,4-dimethyl-8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 153447006) has the molecular formula C27H30IrNO3- and a molecular weight of 608.76 g/mol. Its IUPAC name is 2,4-dimethyl-8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2,4-dimethyl-8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 153447006 |
| Molecular Formula | C27H30IrNO3- |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 2,4-dimethyl-8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1[c-]c2c(c(C)c1)COc1cc3c(CC(C)C)cccc3nc1-2.[Ir] |
| InChI | InChI=1S/C22H22NO.C5H8O2.Ir/c1-13(2)8-16-6-5-7-20-17(16)11-21-22(23-20)18-10-14(3)9-15(4)19(18)12-24-21;1-4(6)3-5(2)7;/h5-7,9,11,13H,8,12H2,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | ALXRTAGCKFTSLB-LWFKIUJUSA-N |
| XLogP | 6.44 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|