C25H26IrNO3- — CID 153447074
(Z)-4-hydroxypent-3-en-2-one;iridium;8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide (PubChem CID 153447074) has the molecular formula C25H26IrNO3- and a molecular weight of 580.70 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide |
|---|---|
| PubChem CID | 153447074 |
| Molecular Formula | C25H26IrNO3- |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide |
| SMILES | CC(=O)/C=C(/C)O.CC(C)Cc1cccc2nc3c(cc12)OCc1ccc[c-]c1-3.[Ir] |
| InChI | InChI=1S/C20H18NO.C5H8O2.Ir/c1-13(2)10-14-7-5-9-18-17(14)11-19-20(21-18)16-8-4-3-6-15(16)12-22-19;1-4(6)3-5(2)7;/h3-7,9,11,13H,10,12H2,1-2H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | WAGHBHCVGVZFFE-LWFKIUJUSA-N |
| XLogP | 5.83 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|