About 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate
2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate (PubChem CID 153447646) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate |
| PubChem CID | 153447646 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate |
| SMILES | CC(C)(C)CCNC(=O)OCC(C)(C)C |
| InChI | InChI=1S/C12H25NO2/c1-11(2,3)7-8-13-10(14)15-9-12(4,5)6/h7-9H2,1-6H3,(H,13,14) |
| InChIKey | GOVRVVLRRRRDOG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate?
The IUPAC name of 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate (CID 153447646) is 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate.
What is the SMILES notation for 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate?
The canonical SMILES for 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate is CC(C)(C)CCNC(=O)OCC(C)(C)C.
What is the InChIKey of 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate?
The InChIKey is GOVRVVLRRRRDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-11(2,3)7-8-13-10(14)15-9-12(4,5)6/h7-9H2,1-6H3,(H,13,14).
What are the key properties of 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate?
2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate has a molecular weight of 215.34 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl N-(3,3-dimethylbutyl)carbamate is sourced from PubChem (CID 153447646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).