About piperidin-1-ium;bis(rubidium(1+))
piperidin-1-ium;bis(rubidium(1+)) (PubChem CID 153447813) has the molecular formula C5H12NRb2+3
and a molecular weight of 257.09 g/mol. Its IUPAC name is piperidin-1-ium;bis(rubidium(1+)).
Molecular Properties
| Compound Name | piperidin-1-ium;bis(rubidium(1+)) |
| PubChem CID | 153447813 |
| Molecular Formula | C5H12NRb2+3 |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.92 |
| IUPAC Name | piperidin-1-ium;bis(rubidium(1+)) |
| SMILES | C1CC[NH2+]CC1.[Rb+].[Rb+] |
| InChI | InChI=1S/C5H11N.2Rb/c1-2-4-6-5-3-1;;/h6H,1-5H2;;/q;2*+1/p+1 |
| InChIKey | TWRDKCRHOPHIPH-UHFFFAOYSA-O |
| XLogP | -6.26 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | -6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze piperidin-1-ium;bis(rubidium(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-ium;bis(rubidium(1+))?
The IUPAC name of piperidin-1-ium;bis(rubidium(1+)) (CID 153447813) is piperidin-1-ium;bis(rubidium(1+)).
What is the SMILES notation for piperidin-1-ium;bis(rubidium(1+))?
The canonical SMILES for piperidin-1-ium;bis(rubidium(1+)) is C1CC[NH2+]CC1.[Rb+].[Rb+].
What is the InChIKey of piperidin-1-ium;bis(rubidium(1+))?
The InChIKey is TWRDKCRHOPHIPH-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H11N.2Rb/c1-2-4-6-5-3-1;;/h6H,1-5H2;;/q;2*+1/p+1.
What are the key properties of piperidin-1-ium;bis(rubidium(1+))?
piperidin-1-ium;bis(rubidium(1+)) has a molecular weight of 257.09 g/mol, XLogP of -6.26, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-ium;bis(rubidium(1+)) is sourced from PubChem (CID 153447813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).