About 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium
4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium (PubChem CID 153448070) has the molecular formula C19H28N2Pd
and a molecular weight of 390.87 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium.
Molecular Properties
| Compound Name | 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium |
| PubChem CID | 153448070 |
| Molecular Formula | C19H28N2Pd |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium |
| SMILES | Cc1cc(C)cc(-c2c(C)nn(C(C)C)c2CC(C)C)c1.[Pd] |
| InChI | InChI=1S/C19H28N2.Pd/c1-12(2)8-18-19(16(7)20-21(18)13(3)4)17-10-14(5)9-15(6)11-17;/h9-13H,8H2,1-7H3; |
| InChIKey | XIRZTHOORRCMAO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium?
The IUPAC name of 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium (CID 153448070) is 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium.
What is the SMILES notation for 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium?
The canonical SMILES for 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium is Cc1cc(C)cc(-c2c(C)nn(C(C)C)c2CC(C)C)c1.[Pd].
What is the InChIKey of 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium?
The InChIKey is XIRZTHOORRCMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2.Pd/c1-12(2)8-18-19(16(7)20-21(18)13(3)4)17-10-14(5)9-15(6)11-17;/h9-13H,8H2,1-7H3;.
What are the key properties of 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium?
4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium has a molecular weight of 390.87 g/mol, XLogP of 5.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylphenyl)-3-methyl-5-(2-methylpropyl)-1-propan-2-ylpyrazole;palladium is sourced from PubChem (CID 153448070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).