C15H22O7 — CID 15344808
[(2S,3R,4R,5R)-4,5-diacetyloxy-2-methyl-6-prop-2-enyloxan-3-yl] acetate (PubChem CID 15344808) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-4,5-diacetyloxy-2-methyl-6-prop-2-enyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5R)-4,5-diacetyloxy-2-methyl-6-prop-2-enyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 15344808 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(2S,3R,4R,5R)-4,5-diacetyloxy-2-methyl-6-prop-2-enyloxan-3-yl] acetate |
| SMILES | C=CCC1O[C@@H](C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H22O7/c1-6-7-12-14(21-10(4)17)15(22-11(5)18)13(8(2)19-12)20-9(3)16/h6,8,12-15H,1,7H2,2-5H3/t8-,12?,13+,14+,15+/m0/s1 |
| InChIKey | PRUAJEBYYJKUEH-BRRSXXPQSA-N |
| XLogP | 1.14 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|