About [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate
[1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate (PubChem CID 153448524) has the molecular formula C22H32F2N2O2
and a molecular weight of 394.51 g/mol. Its IUPAC name is [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate.
Molecular Properties
| Compound Name | [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate |
| PubChem CID | 153448524 |
| Molecular Formula | C22H32F2N2O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate |
| SMILES | CC(C)CN(c1ccc(C2(OC=O)CCCC2)cc1N)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C22H32F2N2O2/c1-16(2)14-26(18-7-11-22(23,24)12-8-18)20-6-5-17(13-19(20)25)21(28-15-27)9-3-4-10-21/h5-6,13,15-16,18H,3-4,7-12,14,25H2,1-2H3 |
| InChIKey | FTMWOTCMNDIYBI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate?
The IUPAC name of [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate (CID 153448524) is [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate.
What is the SMILES notation for [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate?
The canonical SMILES for [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate is CC(C)CN(c1ccc(C2(OC=O)CCCC2)cc1N)C1CCC(F)(F)CC1.
What is the InChIKey of [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate?
The InChIKey is FTMWOTCMNDIYBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32F2N2O2/c1-16(2)14-26(18-7-11-22(23,24)12-8-18)20-6-5-17(13-19(20)25)21(28-15-27)9-3-4-10-21/h5-6,13,15-16,18H,3-4,7-12,14,25H2,1-2H3.
What are the key properties of [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate?
[1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate has a molecular weight of 394.51 g/mol, XLogP of 5.25, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-amino-4-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]phenyl]cyclopentyl] formate is sourced from PubChem (CID 153448524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).